What is the molecular formula of Diphenyldiethoxysilane?
The molecular formula of Diphenyldiethoxysilane is C16H20O2Si.
What are the synonyms of Diphenyldiethoxysilane?
The synonyms of Diphenyldiethoxysilane are Diethoxydiphenylsilane, 2553-19-7, and Silane, diethoxydiphenyl.
What is the molecular weight of Diphenyldiethoxysilane?
The molecular weight of Diphenyldiethoxysilane is 272.41 g/mol.
What is the IUPAC name of Diphenyldiethoxysilane?
The IUPAC name of Diphenyldiethoxysilane is diethoxy(diphenyl)silane.
What is the InChI of Diphenyldiethoxysilane?
The InChI of Diphenyldiethoxysilane is InChI=1S/C16H20O2Si/c1-3-17-19(18-4-2,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3.
What is the InChIKey of Diphenyldiethoxysilane?
The InChIKey of Diphenyldiethoxysilane is ZZNQQQWFKKTOSD-UHFFFAOYSA-N.
What is the canonical SMILES of Diphenyldiethoxysilane?
The canonical SMILES of Diphenyldiethoxysilane is CCO[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCC.
What is the CAS number of Diphenyldiethoxysilane?
The CAS number of Diphenyldiethoxysilane is 2553-19-7.
Is Diphenyldiethoxysilane a covalently-bonded unit?
Yes, Diphenyldiethoxysilane is a covalently-bonded unit.