What is the molecular formula of Triphenylphosphinegold(I) Chloride?
The molecular formula is C18H15AuClP.
What is the molecular weight of Triphenylphosphinegold(I) Chloride?
The molecular weight is 494.7 g/mol.
What are the synonyms for Triphenylphosphinegold(I) Chloride?
The synonyms are Chloro(triphenylphosphine)gold, (triphenylphosphine)gold(i) chloride, and AuCl(PPh3).
What is the CAS number of Triphenylphosphinegold(I) Chloride?
The CAS number is 14243-64-2.
What is the IUPAC name of Triphenylphosphinegold(I) Chloride?
The IUPAC name is gold(1+);triphenylphosphane;chloride.
How many hydrogen bond donor counts does Triphenylphosphinegold(I) Chloride have?
Triphenylphosphinegold(I) Chloride has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Triphenylphosphinegold(I) Chloride have?
Triphenylphosphinegold(I) Chloride has 1 hydrogen bond acceptor count.
How many rotatable bond counts does Triphenylphosphinegold(I) Chloride have?
Triphenylphosphinegold(I) Chloride has 3 rotatable bond counts.
What is the topological polar surface area of Triphenylphosphinegold(I) Chloride?
The topological polar surface area of Triphenylphosphinegold(I) Chloride is 0-2.
How many covalently-bonded units does Triphenylphosphinegold(I) Chloride have?
Triphenylphosphinegold(I) Chloride has 3 covalently-bonded units.
What is the molecular formula of (Triphenylphosphine)gold(I) Chloride?
The molecular formula is C18H15AuClP.
What is the molecular weight of (Triphenylphosphine)gold(I) Chloride?
The molecular weight is 494.7 g/mol.
What are the synonyms for (Triphenylphosphine)gold(I) Chloride?
The synonyms are Chloro(triphenylphosphine)gold, (triphenylphosphine)gold(i) chloride, Triphenylphosphine gold chloride, and AuCl(PPh3).
What are the component compounds of (Triphenylphosphine)gold(I) Chloride?
The component compounds are Triphenylphosphine, Gold, and Hydrochloric Acid.
What is the IUPAC name of (Triphenylphosphine)gold(I) Chloride?
The IUPAC name is gold(1+);triphenylphosphane;chloride.
What is the InChI of (Triphenylphosphine)gold(I) Chloride?
The InChI is InChI=1S/C18H15P.Au.ClH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;;1H/q;+1;/p-1.
What is the InChIKey of (Triphenylphosphine)gold(I) Chloride?
The InChIKey is IFPWCRBNZXUWGC-UHFFFAOYSA-M.
What is the canonical SMILES of (Triphenylphosphine)gold(I) Chloride?
The canonical SMILES is C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-].[Au+].
What is the CAS number of (Triphenylphosphine)gold(I) Chloride?
The CAS number is 14243-64-2.