What is the molecular formula of 4H-Thiopyrano[4,3-d]thiazole,6,7-dihydro?
The molecular formula is C6H7NS2.
What is the molecular weight of 4H-Thiopyrano[4,3-d]thiazole,6,7-dihydro?
The molecular weight is 157.3 g/mol.
When was 4H-Thiopyrano[4,3-d]thiazole,6,7-dihydro created in PubChem?
It was created on 2007-12-05.
What is the IUPAC Name of 4H-Thiopyrano[4,3-d]thiazole,6,7-dihydro?
The IUPAC Name is 6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazole.
What is the InChI of 4H-Thiopyrano[4,3-d]thiazole,6,7-dihydro?
The InChI is InChI=1S/C6H7NS2/c1-2-8-3-6-5(1)7-4-9-6/h4H,1-3H2.
How many hydrogen bond donor count does 4H-Thiopyrano[4,3-d]thiazole,6,7-dihydro have?
It has 0 hydrogen bond donor counts.
What is the topological polar surface area of 4H-Thiopyrano[4,3-d]thiazole,6,7-dihydro?
The topological polar surface area is 66.4 Ų.
How many heavy atoms are present in 4H-Thiopyrano[4,3-d]thiazole,6,7-dihydro?
There are 9 heavy atoms present.
Is 4H-Thiopyrano[4,3-d]thiazole,6,7-dihydro considered a canonicalized compound in PubChem?
Yes, it is considered canonicalized.
What is the exact mass of 4H-Thiopyrano[4,3-d]thiazole,6,7-dihydro?
The exact mass is 157.00199157 g/mol.