What is the molecular formula of 3,7-Dimethyloct-6-en-2-yl propionate?
The molecular formula is C13H24O2.
When was the structure of 3,7-Dimethyloct-6-en-2-yl propionate created and modified?
The structure was created on 2005-08-08 and modified on 2023-12-30.
What is the IUPAC name of 3,7-Dimethyloct-6-en-2-yl propionate?
The IUPAC name is 3,7-dimethyloct-6-en-2-yl propanoate.
What is the InChI of 3,7-Dimethyloct-6-en-2-yl propionate?
The InChI is InChI=1S/C13H24O2/c1-6-13(14)15-12(5)11(4)9-7-8-10(2)3/h8,11-12H,6-7,9H2,1-5H3.
What is the InChIKey of 3,7-Dimethyloct-6-en-2-yl propionate?
The InChIKey is PVOXDQPDUIZDLB-UHFFFAOYSA-N.
How many rotatable bonds are there in 3,7-Dimethyloct-6-en-2-yl propionate?
There are 7 rotatable bonds.
What is the exact mass of 3,7-Dimethyloct-6-en-2-yl propionate?
The exact mass is 212.177630004 g/mol.
How many hydrogen bond acceptors are there in 3,7-Dimethyloct-6-en-2-yl propionate?
There are 2 hydrogen bond acceptors.
Is 3,7-Dimethyloct-6-en-2-yl propionate a canonicalized compound?
Yes, it is a canonicalized compound.
How many defined atom stereocenters are there in 3,7-Dimethyloct-6-en-2-yl propionate?
There are 0 defined atom stereocenters.