What is the molecular formula of bendamustine?
The molecular formula of bendamustine is C16H21Cl2N3O2.
What is the molecular weight of bendamustine?
The molecular weight of bendamustine is 358.3 g/mol.
What is the IUPAC name of bendamustine?
The IUPAC name of bendamustine is 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid.
What is the InChI of bendamustine?
The InChI of bendamustine is InChI=1S/C16H21Cl2N3O2/c1-20-14-6-5-12(21(9-7-17)10-8-18)11-13(14)19-15(20)3-2-4-16(22)23/h5-6,11H,2-4,7-10H2,1H3,(H,22,23).
What is the InChIKey of bendamustine?
The InChIKey of bendamustine is YTKUWDBFDASYHO-UHFFFAOYSA-N.
What is the CAS number of bendamustine?
The CAS number of bendamustine is 16506-27-7.
What is the common name of bendamustine?
The common name of bendamustine is bendamustine.
What is the pharmacological class of bendamustine?
The pharmacological class of bendamustine is an alkylating drug.
What is the chemical structure of bendamustine?
The chemical structure of bendamustine is a member of benzimidazoles.
What is the indication for the use of bendamustine?
Bendamustine is indicated for the treatment of chronic lymphocytic leukemia (CLL) and indolent B-cell non-Hodgkin lymphoma (NHL) that has progressed during or within six months of treatment with rituximab or a rituximab-containing regimen.