What is the molecular formula of Naphth[2,1-d][1,2,3]oxadiazole-6-sulfonyl chloride?
The molecular formula is C10H5ClN2O3S.
When was Naphth[2,1-d][1,2,3]oxadiazole-6-sulfonyl chloride created in PubChem?
It was created on August 20, 2009.
What is the IUPAC name of Naphth[2,1-d][1,2,3]oxadiazole-6-sulfonyl chloride?
The IUPAC name is benzo[g][1,2,3]benzoxadiazole-6-sulfonyl chloride.
How is the InChI of Naphth[2,1-d][1,2,3]oxadiazole-6-sulfonyl chloride computed?
The InChI is computed by InChI 1.0.6.
What is the Canonical SMILES of Naphth[2,1-d][1,2,3]oxadiazole-6-sulfonyl chloride?
The Canonical SMILES is C1=CC2=C(C=CC3=C2ON=N3)C(=C1)S(=O)(=O)Cl.
What is the CAS number of Naphth[2,1-d][1,2,3]oxadiazole-6-sulfonyl chloride?
The CAS number is 97552-60-8.
What is the molecular weight of Naphth[2,1-d][1,2,3]oxadiazole-6-sulfonyl chloride?
The molecular weight is 268.68 g/mol.
How many hydrogen bond acceptor counts does Naphth[2,1-d][1,2,3]oxadiazole-6-sulfonyl chloride have?
It has 5 hydrogen bond acceptor counts.
What is the topological polar surface area of Naphth[2,1-d][1,2,3]oxadiazole-6-sulfonyl chloride?
The topological polar surface area is 81.4 Å2.
Is the compound Naphth[2,1-d][1,2,3]oxadiazole-6-sulfonyl chloride canonicalized?
Yes, the compound is canonicalized according to PubChem.