What is the molecular formula of 2,3,3-Trifluoro-N,N-dimethylacrylamide?
The molecular formula is C5H6F3NO.
What is the molecular weight of 2,3,3-Trifluoro-N,N-dimethylacrylamide?
The molecular weight is 153.10 g/mol.
What is the IUPAC name of 2,3,3-Trifluoro-N,N-dimethylacrylamide?
The IUPAC name is 2,3,3-trifluoro-N,N-dimethylprop-2-enamide.
What is the InChI of 2,3,3-Trifluoro-N,N-dimethylacrylamide?
The InChI is InChI=1S/C5H6F3NO/c1-9(2)5(10)3(6)4(7)8/h1-2H3.
What is the InChIKey of 2,3,3-Trifluoro-N,N-dimethylacrylamide?
The InChIKey is GPIMQYBOJVUWSK-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 2,3,3-Trifluoro-N,N-dimethylacrylamide have?
It has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2,3,3-Trifluoro-N,N-dimethylacrylamide have?
It has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of 2,3,3-Trifluoro-N,N-dimethylacrylamide?
The topological polar surface area is 20.3 Ų.
Is 2,3,3-Trifluoro-N,N-dimethylacrylamide a canonicalized compound?
Yes, it is a canonicalized compound.
When was 2,3,3-Trifluoro-N,N-dimethylacrylamide created and last modified?
It was created on 2005-08-08 and last modified on 2023-12-30.