What is the molecular formula of 4,6-Dichloro-7H-pyrrolo[2,3-d]pyrimidine?
The molecular formula is C6H3Cl2N3.
What is the molecular weight of 4,6-Dichloro-7H-pyrrolo[2,3-d]pyrimidine?
The molecular weight is 188.01 g/mol.
What is the IUPAC name of 4,6-Dichloro-7H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name is 4,6-dichloro-7H-pyrrolo[2,3-d]pyrimidine.
What is the structure of 4,6-Dichloro-7H-pyrrolo[2,3-d]pyrimidine?
The structure is C1=C(NC2=C1C(=NC=N2)Cl)Cl.
What are the synonyms for 4,6-Dichloro-7H-pyrrolo[2,3-d]pyrimidine?
Some synonyms include 97337-32-1, MFCD11518912, and SCHEMBL15618278.
What is the InChIKey for 4,6-Dichloro-7H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is CGTRULURZFVPIX-UHFFFAOYSA-N.
How many hydrogen bond donor counts are there in 4,6-Dichloro-7H-pyrrolo[2,3-d]pyrimidine?
There is 1 hydrogen bond donor count.
What is the topological polar surface area of 4,6-Dichloro-7H-pyrrolo[2,3-d]pyrimidine?
The topological polar surface area is 41.6 Ų.
Is 4,6-Dichloro-7H-pyrrolo[2,3-d]pyrimidine considered as a canonicalized compound?
Yes, it is considered a canonicalized compound.
What is the compound's complexity value?
The complexity value is 155.