What is the chemical structure of 2H-Pyrrol-2-one, 1-acetyl-1,5-dihydro-4-methoxy-(9CI)?
The chemical structure is C7H9NO3.
What are some synonyms for 2H-Pyrrol-2-one, 1-acetyl-1,5-dihydro-4-methoxy-(9CI)?
Some synonyms include 96909-02-3 and CHEMBL2147273.
What is the molecular weight of 2H-Pyrrol-2-one, 1-acetyl-1,5-dihydro-4-methoxy-(9CI)?
The molecular weight is 155.15 g/mol.
What is the IUPAC name of 2H-Pyrrol-2-one, 1-acetyl-1,5-dihydro-4-methoxy-(9CI)?
The IUPAC name is 1-acetyl-3-methoxy-2H-pyrrol-5-one.
What is the InChI of 2H-Pyrrol-2-one, 1-acetyl-1,5-dihydro-4-methoxy-(9CI)?
The InChI is InChI=1S/C7H9NO3/c1-5(9)8-4-6(11-2)3-7(8)10/h3H,4H2,1-2H3.
What is the InChIKey of 2H-Pyrrol-2-one, 1-acetyl-1,5-dihydro-4-methoxy-(9CI)?
The InChIKey is DSKQQFYTVZYDFQ-UHFFFAOYSA-N.
What is the Canonical SMILES of 2H-Pyrrol-2-one, 1-acetyl-1,5-dihydro-4-methoxy-(9CI)?
The Canonical SMILES is CC(=O)N1CC(=CC1=O)OC.
What is the exact mass of 2H-Pyrrol-2-one, 1-acetyl-1,5-dihydro-4-methoxy-(9CI)?
The exact mass is 155.058243149 g/mol.
How many hydrogen bond acceptors are present in 2H-Pyrrol-2-one, 1-acetyl-1,5-dihydro-4-methoxy-(9CI)?
There are 3 hydrogen bond acceptors.
Is 2H-Pyrrol-2-one, 1-acetyl-1,5-dihydro-4-methoxy-(9CI) a canonicalized compound?
Yes, it is a canonicalized compound.