What is the molecular formula of Crisnatol?
The molecular formula of Crisnatol is C23H23NO2.
What is the molecular weight of Crisnatol?
The molecular weight of Crisnatol is 345.4 g/mol.
What is the IUPAC name of Crisnatol?
The IUPAC name of Crisnatol is 2-(chrysen-6-ylmethylamino)-2-methylpropane-1,3-diol.
What is the InChI of Crisnatol?
The InChI of Crisnatol is InChI=1S/C23H23NO2/c1-23(14-25,15-26)24-13-17-12-22-18-7-3-2-6-16(18)10-11-21(22)20-9-5-4-8-19(17)20/h2-12,24-26H,13-15H2,1H3.
What is the InChIKey of Crisnatol?
The InChIKey of Crisnatol is SBRXTSOCZITGQG-UHFFFAOYSA-N.
What is the canonical SMILES of Crisnatol?
The canonical SMILES of Crisnatol is CC(CO)(CO)NCC1=CC2=C(C=CC3=CC=CC=C32)C4=CC=CC=C41.
What is the CAS number of Crisnatol?
The CAS number of Crisnatol is 96389-68-3.
What is the UNII of Crisnatol?
The UNII of Crisnatol is 2J71UR51UE.
What is the ChEMBL ID of Crisnatol?
The ChEMBL ID of Crisnatol is CHEMBL61495.
Is Crisnatol a canonicalized compound?
Yes, Crisnatol is a canonicalized compound according to PubChem.