What is the molecular formula of Methyl 7-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate?
The molecular formula is C9H7ClN2O2.
What is the molecular weight of Methyl 7-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate?
The molecular weight is 210.62 g/mol.
When was Methyl 7-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate created in PubChem?
It was created on 2010-03-29.
What is the IUPAC name of Methyl 7-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate?
The IUPAC name is methyl 7-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate.
What is the Canonical SMILES representation of Methyl 7-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate?
The Canonical SMILES is COC(=O)C1=CC2=NC=CC(=C2N1)Cl.
What is the InChIKey of Methyl 7-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate?
The InChIKey is DQBUZBSXMBSOIM-UHFFFAOYSA-N.
How many hydrogen bond donor counts are there in Methyl 7-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate?
There is 1 hydrogen bond donor count.
What is the XLogP3-AA value of Methyl 7-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate?
The XLogP3-AA value is 1.9.
What is the topological polar surface area of Methyl 7-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate?
The topological polar surface area is 55Ų.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.