What is the molecular formula of Sornidipine?
The molecular formula of Sornidipine is C22H24N2O9.
When was Sornidipine created and last modified?
Sornidipine was created on August 9, 2005, and last modified on December 30, 2023.
What are some synonyms for Sornidipine?
Some synonyms for Sornidipine include 95105-77-4, CHEMBL2107563, and DTXSID40241758.
What is the molecular weight of Sornidipine?
The molecular weight of Sornidipine is 460.4 g/mol.
What is the IUPAC name of Sornidipine?
The IUPAC name of Sornidipine is 5-O-[(3S,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 3-O-methyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
What is the InChI of Sornidipine?
The InChI of Sornidipine is InChI=1S/C22H24N2O9/c1-10-16(21(26)30-3)18(12-6-4-5-7-13(12)24(28)29)17(11(2)23-10)22(27)33-15-9-32-19-14(25)8-31-20(15)19/h4-7,14-15,18-20,23,25H,8-9H2,1-3H3/t14-,15+,18?,19+,20+/m0/s1.
How many hydrogen bond donor counts are there in Sornidipine?
There are 2 hydrogen bond donor counts in Sornidipine.
What is the XLogP3 value of Sornidipine?
The XLogP3 value of Sornidipine is 1.
How many rotatable bond counts are there in Sornidipine?
There are 6 rotatable bond counts in Sornidipine.
What is the topological polar surface area of Sornidipine?
The topological polar surface area of Sornidipine is 149 Ų.