What is the molecular formula of 2,5,7-Trimethylquinoline-3-carboxylic acid?
The molecular formula is C13H13NO2.
When was 2,5,7-Trimethylquinoline-3-carboxylic acid created in PubChem?
It was created on November 13, 2007.
What is the IUPAC name of 2,5,7-Trimethylquinoline-3-carboxylic acid?
The IUPAC name is 2,5,7-trimethylquinoline-3-carboxylic acid.
What is the Canonical SMILES representation of 2,5,7-Trimethylquinoline-3-carboxylic acid?
The Canonical SMILES is CC1=CC(=C2C=C(C(=NC2=C1)C)C(=O)O)C.
What is the molecular weight of 2,5,7-Trimethylquinoline-3-carboxylic acid?
The molecular weight is 215.25 g/mol.
How many hydrogen bond donor counts does 2,5,7-Trimethylquinoline-3-carboxylic acid have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of 2,5,7-Trimethylquinoline-3-carboxylic acid?
The topological polar surface area is 50.2 Ų.
Is 2,5,7-Trimethylquinoline-3-carboxylic acid a canonicalized compound in PubChem?
Yes, it is a canonicalized compound.
What is the XLogP3-AA value of 2,5,7-Trimethylquinoline-3-carboxylic acid?
The XLogP3-AA value is 2.8.
How many covalently-bonded unit counts does 2,5,7-Trimethylquinoline-3-carboxylic acid have?
It has 1 covalently-bonded unit count.