What is the molecular formula of Isoquinoline, 8-bromo-1,2,3,4-tetrahydro-2-methyl?
The molecular formula is C10H12BrN.
What is the molecular weight of Isoquinoline, 8-bromo-1,2,3,4-tetrahydro-2-methyl?
The molecular weight is 226.11 g/mol.
When was Isoquinoline, 8-bromo-1,2,3,4-tetrahydro-2-methyl created in PubChem?
It was created on July 20, 2011.
When was Isoquinoline, 8-bromo-1,2,3,4-tetrahydro-2-methyl last modified in PubChem?
It was last modified on December 30, 2023.
What is the IUPAC name of Isoquinoline, 8-bromo-1,2,3,4-tetrahydro-2-methyl?
The IUPAC name is 8-bromo-2-methyl-3,4-dihydro-1H-isoquinoline.
What is the InChI of Isoquinoline, 8-bromo-1,2,3,4-tetrahydro-2-methyl?
The InChI is InChI=1S/C10H12BrN/c1-12-6-5-8-3-2-4-10(11)9(8)7-12/h2-4H,5-7H2,1H3.
What is the InChIKey of Isoquinoline, 8-bromo-1,2,3,4-tetrahydro-2-methyl?
The InChIKey is HEVSJNXWDZDGHL-UHFFFAOYSA-N.
What is the canonical SMILES of Isoquinoline, 8-bromo-1,2,3,4-tetrahydro-2-methyl?
The canonical SMILES is CN1CCC2=C(C1)C(=CC=C2)Br.
What is the CAS identifier of Isoquinoline, 8-bromo-1,2,3,4-tetrahydro-2-methyl?
The CAS identifier is 947499-03-8.
What is the molecular weight of Isoquinoline, 8-bromo-1,2,3,4-tetrahydro-2-methyl computed by PubChem?
The molecular weight is 226.11 g/mol, computed by PubChem 2.1.