CAS
946665-36-7 Purity
---
946665-36-7 Purity
---
Shopping basket
3-Methoxy-4-(3-methoxypropoxy)benzaldehyde
CAS
946670-72-0
Catalog Number
ACM946670720
Category
Other Products
Molecular Formula
C12H16O4
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C12H16O4.
What is the molecular weight of the compound?
The molecular weight of the compound is 224.25 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 3-methoxy-4-(3-methoxypropoxy)benzaldehyde.
What is the Canonical SMILES representation of the compound?
The Canonical SMILES representation of the compound is COCCCOC1=C(C=C(C=C1)C=O)OC.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 1.5.
What is the hydrogen bond acceptor count of the compound?
The compound has 4 hydrogen bond acceptor counts.
What is the rotatable bond count of the compound?
The compound has 7 rotatable bond counts.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 44.8 Ų.
Is the compound considered canonicalized?
Yes, the compound is considered canonicalized.
Please kindly note that our products are for research use only.
Recommended Products
CAS
946666-76-8 Purity
---
946666-76-8 Purity
---
CAS
946667-81-8 Purity
---
946667-81-8 Purity
---
