What is the molecular formula of 2,3,4,5,6,7-Hexahydro-4-isopropyl-2,7-dimethyl-1H-inden-1-one?
The molecular formula is C14H22O.
What is the molecular weight of 2,3,4,5,6,7-Hexahydro-4-isopropyl-2,7-dimethyl-1H-inden-1-one?
The molecular weight is 206.32 g/mol.
When was PubChem CID 3024271 created?
It was created on 2005-08-08.
What is the IUPAC name of 2,3,4,5,6,7-Hexahydro-4-isopropyl-2,7-dimethyl-1H-inden-1-one?
The IUPAC name is 2,7-dimethyl-4-propan-2-yl-2,3,4,5,6,7-hexahydroinden-1-one.
What is the Canonical SMILES of 2,3,4,5,6,7-Hexahydro-4-isopropyl-2,7-dimethyl-1H-inden-1-one?
The Canonical SMILES is CC1CCC(C2=C1C(=O)C(C2)C)C(C)C.
What is the InChIKey of 2,3,4,5,6,7-Hexahydro-4-isopropyl-2,7-dimethyl-1H-inden-1-one?
The InChIKey is LLSSPTISLIDNTK-UHFFFAOYSA-N.
How many hydrogen bond donor count does 2,3,4,5,6,7-Hexahydro-4-isopropyl-2,7-dimethyl-1H-inden-1-one have?
It has 0 hydrogen bond donor count.
What is the topological polar surface area of 2,3,4,5,6,7-Hexahydro-4-isopropyl-2,7-dimethyl-1H-inden-1-one?
The topological polar surface area is 17.1 Ų.
How many heavy atoms are present in 2,3,4,5,6,7-Hexahydro-4-isopropyl-2,7-dimethyl-1H-inden-1-one?
There are 15 heavy atoms.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.