What is the molecular formula of Sodium 4,5-dihydro-2-undecyl-1H-imidazole-1-acetate?
The molecular formula is C16H29N2NaO2.
When was Sodium 4,5-dihydro-2-undecyl-1H-imidazole-1-acetate created and last modified?
It was created on February 5, 2008, and last modified on December 30, 2023.
What is the IUPAC name of Sodium 4,5-dihydro-2-undecyl-1H-imidazole-1-acetate?
The IUPAC name is sodium;2-(2-undecyl-4,5-dihydroimidazol-1-yl)acetate.
What is the InChI of Sodium 4,5-dihydro-2-undecyl-1H-imidazole-1-acetate?
The InChI is InChI=1S/C16H30N2O2.Na/c1-2-3-4-5-6-7-8-9-10-11-15-17-12-13-18(15)14-16(19)20;/h2-14H2,1H3,(H,19,20);/q;+1/p-1.
What is the Canonical SMILES of Sodium 4,5-dihydro-2-undecyl-1H-imidazole-1-acetate?
The Canonical SMILES is CCCCCCCCCCCC1=NCCN1CC(=O)[O-].[Na+].
What is the molecular weight of Sodium 4,5-dihydro-2-undecyl-1H-imidazole-1-acetate?
The molecular weight is 304.40 g/mol.
How many hydrogen bond acceptor counts does Sodium 4,5-dihydro-2-undecyl-1H-imidazole-1-acetate have?
It has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of Sodium 4,5-dihydro-2-undecyl-1H-imidazole-1-acetate?
The topological polar surface area is 55.7 Angstrom^2.
How many rotatable bond counts does Sodium 4,5-dihydro-2-undecyl-1H-imidazole-1-acetate have?
It has 12 rotatable bond counts.
Is Sodium 4,5-dihydro-2-undecyl-1H-imidazole-1-acetate a canonicalized compound?
Yes, it is a canonicalized compound.