What is the molecular formula of Allophanic acid, 1-cyclopropyl-1-methyl-3-butynyl ester?
The molecular formula is C10H14N2O3.
What is the molecular weight of Allophanic acid, 1-cyclopropyl-1-methyl-3-butynyl ester?
The molecular weight is 210.23 g/mol.
When was Allophanic acid, 1-cyclopropyl-1-methyl-3-butynyl ester created?
It was created on March 30, 2010.
What is the IUPAC name of Allophanic acid, 1-cyclopropyl-1-methyl-3-butynyl ester?
The IUPAC name is 2-cyclopropylpent-4-yn-2-yl N-carbamoylcarbamate.
What is the InChI code of Allophanic acid, 1-cyclopropyl-1-methyl-3-butynyl ester?
The InChI code is InChI=1S/C10H14N2O3/c1-3-6-10(2,7-4-5-7)15-9(14)12-8(11)13/h1,7H,4-6H2,2H3,(H3,11,12,13,14).
What is the InChIKey of Allophanic acid, 1-cyclopropyl-1-methyl-3-butynyl ester?
The InChIKey is MRJXZGDNGANHFH-UHFFFAOYSA-N.
What is the canonical SMILES of Allophanic acid, 1-cyclopropyl-1-methyl-3-butynyl ester?
The canonical SMILES is CC(CC#C)(C1CC1)OC(=O)NC(=O)N.
What is the XLogP3-AA value of Allophanic acid, 1-cyclopropyl-1-methyl-3-butynyl ester?
The XLogP3-AA value is 1.3.
How many hydrogen bond donor counts does Allophanic acid, 1-cyclopropyl-1-methyl-3-butynyl ester have?
It has 2 hydrogen bond donor counts.
How many rotatable bond counts does Allophanic acid, 1-cyclopropyl-1-methyl-3-butynyl ester have?
It has 4 rotatable bond counts.