What is the molecular formula of 3-Pyridinecarboxaldehyde,2-chloro-5-(trifluoromethyl)?
The molecular formula is C7H3ClF3NO.
What is the PubChem CID of 3-Pyridinecarboxaldehyde,2-chloro-5-(trifluoromethyl)?
The PubChem CID is 46864081.
What is the IUPAC name of 3-Pyridinecarboxaldehyde,2-chloro-5-(trifluoromethyl)?
The IUPAC name is 2-chloro-5-(trifluoromethyl)pyridine-3-carbaldehyde.
What is the InChI of 3-Pyridinecarboxaldehyde,2-chloro-5-(trifluoromethyl)?
The InChI is InChI=1S/C7H3ClF3NO/c8-6-4(3-13)1-5(2-12-6)7(9,10)11/h1-3H.
What is the InChIKey of 3-Pyridinecarboxaldehyde,2-chloro-5-(trifluoromethyl)?
The InChIKey is DSJPRZOKABVBLR-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Pyridinecarboxaldehyde,2-chloro-5-(trifluoromethyl)?
The canonical SMILES is C1=C(C=NC(=C1C=O)Cl)C(F)(F)F.
What is the molecular weight of 3-Pyridinecarboxaldehyde,2-chloro-5-(trifluoromethyl)?
The molecular weight is 209.55 g/mol.
What is the XLogP3-AA of 3-Pyridinecarboxaldehyde,2-chloro-5-(trifluoromethyl)?
The XLogP3-AA is 2.2.
How many hydrogen bond donor counts does 3-Pyridinecarboxaldehyde,2-chloro-5-(trifluoromethyl) have?
It has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3-Pyridinecarboxaldehyde,2-chloro-5-(trifluoromethyl) have?
It has 5 hydrogen bond acceptor counts.