933743-55-6 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C6H5BrN2O2.
The molecular weight of the compound is 217.02 g/mol.
The IUPAC name of the compound is 5-bromo-4-methylpyrimidine-2-carboxylic acid.
The InChI of the compound is InChI=1S/C6H5BrN2O2/c1-3-4(7)2-8-5(9-3)6(10)11/h2H,1H3,(H,10,11).
The InChIKey of the compound is YANXNZGTQDRSSC-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=NC(=NC=C1Br)C(=O)O.
The XLogP3-AA value of the compound is 1.2.
The hydrogen bond donor count of the compound is 1.
The hydrogen bond acceptor count of the compound is 4.
The topological polar surface area of the compound is 63.1 ?2.
Please kindly note that our products are for research use only.
Download