925916-73-0 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C9H13BO4S.
The molecular weight of the compound is 228.08 g/mol.
The IUPAC name of the compound is [5-[(2-methylpropan-2-yl)oxycarbonyl]thiophen-2-yl]boronic acid.
The InChI of the compound is InChI=1S/C9H13BO4S/c1-9(2,3)14-8(11)6-4-5-7(15-6)10(12)13/h4-5,12-13H,1-3H3.
The InChIKey of the compound is LKQDOTUUIDJQFS-UHFFFAOYSA-N.
The canonical SMILES of the compound is B(C1=CC=C(S1)C(=O)OC(C)(C)C)(O)O.
The CAS number of the compound is 925921-29-5.
The hydrogen bond donor count of the compound is 2.
The hydrogen bond acceptor count of the compound is 5.
Yes, the compound is canonicalized.
Please kindly note that our products are for research use only.
Download