What is the molecular formula of tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate?
The molecular formula is C13H22N2O3.
What is the molecular weight of tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate?
The molecular weight is 254.33 g/mol.
What is the IUPAC name of tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate?
The IUPAC name is tert-butyl 1-oxo-2,9-diazaspiro[4.5]decane-9-carboxylate.
What is the InChI of tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate?
The InChI is InChI=1S/C13H22N2O3/c1-12(2,3)18-11(17)15-8-4-5-13(9-15)6-7-14-10(13)16/h4-9H2,1-3H3,(H,14,16).
What is the InChIKey of tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate?
The InChIKey is QCRYPCJMEOXBJL-UHFFFAOYSA-N.
What is the canonical SMILES of tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate?
The canonical SMILES is CC(C)(C)OC(=O)N1CCCC2(C1)CCNC2=O.
What is the CAS number of tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate?
The CAS number is 923009-50-1.
What is the XLogP3-AA value of tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate?
The XLogP3-AA value is 0.8.
How many hydrogen bond donor counts does tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate have?
It has 3 hydrogen bond acceptor counts.