What is the molecular formula of Ethanesulfonic acid, 1-hydroxy-, sodium salt(1:1)?
The molecular formula is C2H5NaO4S.
What is the molecular weight of Ethanesulfonic acid, 1-hydroxy-, sodium salt(1:1)?
The molecular weight is 148.12 g/mol.
What are some synonyms for Ethanesulfonic acid, 1-hydroxy-, sodium salt(1:1)?
Some synonyms include Acetaldehyde sodium bisulfite and Sodium 1-hydroxyethanesulfonate.
What is the IUPAC name of Ethanesulfonic acid, 1-hydroxy-, sodium salt(1:1)?
The IUPAC name is sodium;1-hydroxyethanesulfonate.
What is the InChIKey of Ethanesulfonic acid, 1-hydroxy-, sodium salt(1:1)?
The InChIKey is CZDZQGXAHZVGPL-UHFFFAOYSA-M.
What is the canonical SMILES of Ethanesulfonic acid, 1-hydroxy-, sodium salt(1:1)?
The canonical SMILES is CC(O)S(=O)(=O)[O-].[Na+].
What is the CAS number of Ethanesulfonic acid, 1-hydroxy-, sodium salt(1:1)?
The CAS number is 918-04-7.
How many Hydrogen Bond Donor Count does Ethanesulfonic acid, 1-hydroxy-, sodium salt(1:1) have?
It has 1 Hydrogen Bond Donor Count.
What is the Exact Mass of Ethanesulfonic acid, 1-hydroxy-, sodium salt(1:1)?
The Exact Mass is 147.98062409 g/mol.
How many Hydrogen Bond Acceptor Count does Ethanesulfonic acid, 1-hydroxy-, sodium salt(1:1) have?
It has 4 Hydrogen Bond Acceptor Count.