What is the molecular formula of 6-Chloropyrazolo[1,5-a]pyrimidine-2-carboxylic acid?
The molecular formula is C7H4ClN3O2.
When was 6-Chloropyrazolo[1,5-a]pyrimidine-2-carboxylic acid created in PubChem?
It was created on May 29, 2009.
What is the molecular weight of 6-Chloropyrazolo[1,5-a]pyrimidine-2-carboxylic acid?
The molecular weight is 197.58 g/mol.
What is the IUPAC name of 6-Chloropyrazolo[1,5-a]pyrimidine-2-carboxylic acid?
The IUPAC name is 6-chloropyrazolo[1,5-a]pyrimidine-2-carboxylic acid.
What is the Canonical SMILES representation of 6-Chloropyrazolo[1,5-a]pyrimidine-2-carboxylic acid?
The Canonical SMILES is C1=C2N=CC(=CN2N=C1C(=O)O)Cl.
How many heavy atoms are present in 6-Chloropyrazolo[1,5-a]pyrimidine-2-carboxylic acid?
There are 13 heavy atoms.
What is the topological polar surface area of 6-Chloropyrazolo[1,5-a]pyrimidine-2-carboxylic acid?
The topological polar surface area is 67.5 Ų.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.
How many hydrogen bond donor counts are there in 6-Chloropyrazolo[1,5-a]pyrimidine-2-carboxylic acid?
There is 1 hydrogen bond donor count.
What is the InChIKey of 6-Chloropyrazolo[1,5-a]pyrimidine-2-carboxylic acid?
The InChIKey is OMMFRAJZXXJIMG-UHFFFAOYSA-N.