What is the molecular formula of 2-[(4-Ethoxyphenyl)amino]nicotinic acid?
The molecular formula of 2-[(4-Ethoxyphenyl)amino]nicotinic acid is C14H14N2O3.
When was 2-[(4-Ethoxyphenyl)amino]nicotinic acid first created?
2-[(4-Ethoxyphenyl)amino]nicotinic acid was first created on July 10, 2005.
What is the molecular weight of 2-[(4-Ethoxyphenyl)amino]nicotinic acid?
The molecular weight of 2-[(4-Ethoxyphenyl)amino]nicotinic acid is 258.27 g/mol.
What are some synonyms for 2-[(4-Ethoxyphenyl)amino]nicotinic acid?
Some synonyms for 2-[(4-Ethoxyphenyl)amino]nicotinic acid include 2-[(4-ethoxyphenyl)amino]pyridine-3-carboxylic acid and 2-((4-Ethoxyphenyl)amino)nicotinic acid.
What is the Canonical SMILES notation for 2-[(4-Ethoxyphenyl)amino]nicotinic acid?
The Canonical SMILES notation for 2-[(4-Ethoxyphenyl)amino]nicotinic acid is CCOC1=CC=C(C=C1)NC2=C(C=CC=N2)C(=O)O.
How many hydrogen bond donor counts does 2-[(4-Ethoxyphenyl)amino]nicotinic acid have?
2-[(4-Ethoxyphenyl)amino]nicotinic acid has 2 hydrogen bond donor counts.
What is the XLogP3-AA value for 2-[(4-Ethoxyphenyl)amino]nicotinic acid?
The XLogP3-AA value for 2-[(4-Ethoxyphenyl)amino]nicotinic acid is 3.1.
What is the topological polar surface area of 2-[(4-Ethoxyphenyl)amino]nicotinic acid?
The topological polar surface area of 2-[(4-Ethoxyphenyl)amino]nicotinic acid is 71.4 Å^2.
How many rotatable bond counts does 2-[(4-Ethoxyphenyl)amino]nicotinic acid have?
2-[(4-Ethoxyphenyl)amino]nicotinic acid has 5 rotatable bond counts.
Is 2-[(4-Ethoxyphenyl)amino]nicotinic acid a canonicalized compound?
Yes, 2-[(4-Ethoxyphenyl)amino]nicotinic acid is a canonicalized compound.
※ Please kindly note that our products are for research use only.