CAS
91085-56-2 Purity
---
91085-56-2 Purity
---
Shopping basket
Piperazine,1-(2,3-epoxypropyl)-4-ethyl-(7ci)
CAS
91086-24-7
Catalog Number
ACM91086247
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular weight of Piperazine, 1-(2,3-epoxypropyl)-4-ethyl-(7ci)?
The molecular weight is 170.25 g/mol.
What is the IUPAC name of Piperazine, 1-(2,3-epoxypropyl)-4-ethyl-(7ci)?
The IUPAC name is 1-ethyl-4-(oxiran-2-ylmethyl)piperazine.
What is the InChI of Piperazine, 1-(2,3-epoxypropyl)-4-ethyl-(7ci)?
The InChI is InChI=1S/C9H18N2O/c1-2-10-3-5-11(6-4-10)7-9-8-12-9/h9H,2-8H2,1H3.
How many hydrogen bond acceptor counts does Piperazine, 1-(2,3-epoxypropyl)-4-ethyl-(7ci) have?
It has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of Piperazine, 1-(2,3-epoxypropyl)-4-ethyl-(7ci)?
The topological polar surface area is 192.
Does Piperazine, 1-(2,3-epoxypropyl)-4-ethyl-(7ci) have any defined atom stereocenter count?
No, it does not have any defined atom stereocenter count.
What is the XLogP3-AA value of Piperazine, 1-(2,3-epoxypropyl)-4-ethyl-(7ci)?
The XLogP3-AA value is 0.1.
How many rotatable bond counts does Piperazine, 1-(2,3-epoxypropyl)-4-ethyl-(7ci) have?
It has 3 rotatable bond counts.
Is Piperazine, 1-(2,3-epoxypropyl)-4-ethyl-(7ci) a canonicalized compound?
Yes, it is a canonicalized compound.
What is the formal charge of Piperazine, 1-(2,3-epoxypropyl)-4-ethyl-(7ci)?
The formal charge is 0.
Recommended Products
![ACETAMIDE,N-[3-(PIPERIDIN-4-YLAMINO)PHENYL]-](https://resource.alfa-chemistry.com/structure/910876-08-3.gif)
