What is the molecular formula of 3,8-Dihydro-1H-indeno[1,2-d]imidazol-2-one?
The molecular formula is C10H8N2O.
When was 3,8-Dihydro-1H-indeno[1,2-d]imidazol-2-one created in PubChem?
It was created on November 16, 2007.
What is the IUPAC Name of 3,8-Dihydro-1H-indeno[1,2-d]imidazol-2-one?
The IUPAC Name is 3,4-dihydro-1H-indeno[1,2-d]imidazol-2-one.
What is the InChIKey of 3,8-Dihydro-1H-indeno[1,2-d]imidazol-2-one?
The InChIKey is AZPSZGVUOVYXSO-UHFFFAOYSA-N.
What is the Canonical SMILES of 3,8-Dihydro-1H-indeno[1,2-d]imidazol-2-one?
The Canonical SMILES is C1C2=CC=CC=C2C3=C1NC(=O)N3.
What is the molecular weight of 3,8-Dihydro-1H-indeno[1,2-d]imidazol-2-one?
The molecular weight is 172.18 g/mol.
How many hydrogen bond donor counts does 3,8-Dihydro-1H-indeno[1,2-d]imidazol-2-one have?
It has 2 hydrogen bond donor counts.
What is the topological polar surface area of 3,8-Dihydro-1H-indeno[1,2-d]imidazol-2-one?
The topological polar surface area is 41.1 Å2.
How many heavy atom counts does 3,8-Dihydro-1H-indeno[1,2-d]imidazol-2-one have?
It has 13 heavy atom counts.
Is 3,8-Dihydro-1H-indeno[1,2-d]imidazol-2-one a canonicalized compound in PubChem?
Yes, it is a canonicalized compound.