What is the molecular formula of 1,3,4-Thiadiazol-2-amine,5-(1-methylcyclopropyl)-?
The molecular formula is C6H9N3S.
What is the molecular weight of 1,3,4-Thiadiazol-2-amine,5-(1-methylcyclopropyl)-?
The molecular weight is 155.22 g/mol.
What is the IUPAC name of 1,3,4-Thiadiazol-2-amine,5-(1-methylcyclopropyl)-?
The IUPAC name is 5-(1-methylcyclopropyl)-1,3,4-thiadiazol-2-amine.
What is the InChI of 1,3,4-Thiadiazol-2-amine,5-(1-methylcyclopropyl)-?
The InChI is InChI=1S/C6H9N3S/c1-6(2-3-6)4-8-9-5(7)10-4/h2-3H2,1H3,(H2,7,9).
What is the InChIKey of 1,3,4-Thiadiazol-2-amine,5-(1-methylcyclopropyl)-?
The InChIKey is YLCDVSLTWVMHOW-UHFFFAOYSA-N.
What is the canonical SMILES of 1,3,4-Thiadiazol-2-amine,5-(1-methylcyclopropyl)-?
The canonical SMILES is CC1(CC1)C2=NN=C(S2)N.
What is the XLogP3-AA value of 1,3,4-Thiadiazol-2-amine,5-(1-methylcyclopropyl)-?
The XLogP3-AA value is 1.1.
How many hydrogen bond donor counts does 1,3,4-Thiadiazol-2-amine,5-(1-methylcyclopropyl)- have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 1,3,4-Thiadiazol-2-amine,5-(1-methylcyclopropyl)- have?
It has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does 1,3,4-Thiadiazol-2-amine,5-(1-methylcyclopropyl)- have?
It has 1 rotatable bond count.