90-65-3 Purity
Purity >98% (HPLC)
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 5-naphthalen-1-yl-3H-furan-2-one.
The molecular formula of the compound is C14H10O2.
The molecular weight of the compound is 210.23 g/mol.
The InChI of the compound is InChI=1S/C14H10O2/c15-14-9-8-13(16-14)12-7-3-5-10-4-1-2-6-11(10)12/h1-8H,9H2.
The InChIKey of the compound is KSFLWMPJLKCMBH-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1C=C(OC1=O)C2=CC=CC3=CC=CC=C32.
The CAS number of the compound is 906560-16-5.
The hydrogen bond donor count of the compound is 0.
The hydrogen bond acceptor count of the compound is 2.
Yes, the compound is canonicalized.
Please kindly note that our products are for research use only.
Download