What is the molecular formula of Olivetolic acid?
The molecular formula of Olivetolic acid is C12H16O4.
What are the synonyms of Olivetolic acid?
The synonyms of Olivetolic acid are 2,4-Dihydroxy-6-pentylbenzoic acid, Olivetolcarboxylic acid, and Allazetolcarboxylic acid.
What is the molecular weight of Olivetolic acid?
The molecular weight of Olivetolic acid is 224.25 g/mol.
What is the role of Olivetolic acid?
Olivetolic acid has a role as a metabolite.
What class of compounds does Olivetolic acid belong to?
Olivetolic acid belongs to the class of benzoic acids.
What is the IUPAC name of Olivetolic acid?
The IUPAC name of Olivetolic acid is 2,4-dihydroxy-6-pentylbenzoic acid.
What is the InChIKey of Olivetolic acid?
The InChIKey of Olivetolic acid is SXFKFRRXJUJGSS-UHFFFAOYSA-N.
What is the canonical SMILES of Olivetolic acid?
The canonical SMILES of Olivetolic acid is CCCCCC1=C(C(=CC(=C1)O)O)C(=O)O.
What is the CAS number of Olivetolic acid?
The CAS number of Olivetolic acid is 491-72-5.
What is the topological polar surface area of Olivetolic acid?
The topological polar surface area of Olivetolic acid is 77.8Ų.