What is the molecular formula of 1-phenoxy-4-vinylbenzene?
The molecular formula of 1-phenoxy-4-vinylbenzene is C14H12O.
What is the molecular weight of 1-phenoxy-4-vinylbenzene?
The molecular weight of 1-phenoxy-4-vinylbenzene is 196.24 g/mol.
What are the synonyms of 1-phenoxy-4-vinylbenzene?
The synonyms of 1-phenoxy-4-vinylbenzene are 4-PHENOXYSTYRENE, p-Phenoxystyrene, and 1-ethenyl-4-phenoxybenzene.
What is the CAS number of 1-phenoxy-4-vinylbenzene?
The CAS number of 1-phenoxy-4-vinylbenzene is 4973-29-9.
What is the IUPAC name of 1-phenoxy-4-vinylbenzene?
The IUPAC name of 1-phenoxy-4-vinylbenzene is 1-ethenyl-4-phenoxybenzene.
What is the InChI of 1-phenoxy-4-vinylbenzene?
The InChI of 1-phenoxy-4-vinylbenzene is InChI=1S/C14H12O/c1-2-12-8-10-14(11-9-12)15-13-6-4-3-5-7-13/h2-11H,1H2.
What is the InChIKey of 1-phenoxy-4-vinylbenzene?
The InChIKey of 1-phenoxy-4-vinylbenzene is UULPGUKSBAXNJN-UHFFFAOYSA-N.
What is the canonical SMILES of 1-phenoxy-4-vinylbenzene?
The canonical SMILES of 1-phenoxy-4-vinylbenzene is C=CC1=CC=C(C=C1)OC2=CC=CC=C2.
What is the XLogP3-AA value of 1-phenoxy-4-vinylbenzene?
The XLogP3-AA value of 1-phenoxy-4-vinylbenzene is 4.2.
How many hydrogen bond acceptor count does 1-phenoxy-4-vinylbenzene have?
1-phenoxy-4-vinylbenzene has 1 hydrogen bond acceptor count.