What is the molecular formula of Ethyl 2-[1-(6-chloro-3-pyridazinyl)-4-piperidyl]acetate?
The molecular formula is C13H18ClN3O2.
What are the synonyms of Ethyl 2-[1-(6-chloro-3-pyridazinyl)-4-piperidyl]acetate?
The synonyms are 1246471-48-6, Ethyl 2-(1-(6-chloropyridazin-3-yl)piperidin-4-yl)acetate, and ETHYL 2-[1-(6-CHLOROPYRIDAZIN-3-YL)PIPERIDIN-4-YL]ACETATE.
What is the molecular weight of Ethyl 2-[1-(6-chloro-3-pyridazinyl)-4-piperidyl]acetate?
The molecular weight is 283.75 g/mol.
When was Ethyl 2-[1-(6-chloro-3-pyridazinyl)-4-piperidyl]acetate created?
It was created on May 8, 2014.
When was Ethyl 2-[1-(6-chloro-3-pyridazinyl)-4-piperidyl]acetate last modified?
It was last modified on December 30, 2023.
What is the IUPAC name of Ethyl 2-[1-(6-chloro-3-pyridazinyl)-4-piperidyl]acetate?
The IUPAC name is ethyl 2-[1-(6-chloropyridazin-3-yl)piperidin-4-yl]acetate.
What is the InChI of Ethyl 2-[1-(6-chloro-3-pyridazinyl)-4-piperidyl]acetate?
The InChI is InChI=1S/C13H18ClN3O2/c1-2-19-13(18)9-10-5-7-17(8-6-10)12-4-3-11(14)15-16-12/h3-4,10H,2,5-9H2,1H3.
What is the InChIKey of Ethyl 2-[1-(6-chloro-3-pyridazinyl)-4-piperidyl]acetate?
The InChIKey is OJTDRIHFGFJLBA-UHFFFAOYSA-N.
What is the Canonical SMILES of Ethyl 2-[1-(6-chloro-3-pyridazinyl)-4-piperidyl]acetate?
The Canonical SMILES is CCOC(=O)CC1CCN(CC1)C2=NN=C(C=C2)Cl.
What is the CAS number of Ethyl 2-[1-(6-chloro-3-pyridazinyl)-4-piperidyl]acetate?
The CAS number is 1246471-48-6.
※ Please kindly note that our products are for research use only.