What is the molecular formula of aldosterone?
The molecular formula of aldosterone is C21H28O5.
What is the molecular weight of aldosterone?
The molecular weight of aldosterone is 360.4 g/mol.
What is the IUPAC name of aldosterone?
The IUPAC name of aldosterone is (8S,9S,10R,11S,13R,14S,17S)-11-hydroxy-17-(2-hydroxyacetyl)-10-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-13-carbaldehyde.
What is the InChIKey of aldosterone?
The InChIKey of aldosterone is PQSUYGKTWSAVDQ-ZVIOFETBSA-N.
What is the canonical SMILES of aldosterone?
The canonical SMILES of aldosterone is CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4C(=O)CO)C=O)O.
What is the CAS number of aldosterone?
The CAS number of aldosterone is 52-39-1.
Does aldosterone regulate electrolyte and water balance?
Yes, aldosterone regulates electrolyte and water balance by increasing the renal retention of sodium and the excretion of potassium.
What is the primary function of aldosterone in the kidney?
The primary function of aldosterone in the kidney is to increase reabsorption of ions and water, leading to sodium conservation, potassium secretion, increased water retention, and increased blood pressure.
Is aldosterone a hormone or a metabolite?
Aldosterone is both a hormone and a metabolite.
Where is aldosterone produced in the body?
Aldosterone is produced by the outer-section (zona glomerulosa) of the adrenal cortex in the adrenal gland.
Download
