What is the molecular formula of 7-Bromooxindole?
The molecular formula of 7-Bromooxindole is C8H6BrNO.
What is the molecular weight of 7-Bromooxindole?
The molecular weight of 7-Bromooxindole is 212.04 g/mol.
What is the CAS number of 7-Bromooxindole?
The CAS number of 7-Bromooxindole is 320734-35-8.
What is the IUPAC name of 7-Bromooxindole?
The IUPAC name of 7-Bromooxindole is 7-bromo-1,3-dihydroindol-2-one.
What is the InChIKey of 7-Bromooxindole?
The InChIKey of 7-Bromooxindole is WSUWXWBRIBGIQT-UHFFFAOYSA-N.
What is the canonical SMILES of 7-Bromooxindole?
The canonical SMILES of 7-Bromooxindole is C1C2=C(C(=CC=C2)Br)NC1=O.
What is the XLogP3-AA value of 7-Bromooxindole?
The XLogP3-AA value of 7-Bromooxindole is 1.5.
How many hydrogen bond donor count does 7-Bromooxindole have?
7-Bromooxindole has 1 hydrogen bond donor count.
How many hydrogen bond acceptor count does 7-Bromooxindole have?
7-Bromooxindole has 1 hydrogen bond acceptor count.
How many rotatable bond count does 7-Bromooxindole have?
7-Bromooxindole has 0 rotatable bond count.