1-Bromo-3-chloro-4-iodobenzene

• CAS: 31928-47-9
• Catalog Number: ACM31928479
• Category: Bromine Series
• Molecular Weight: 317.35
• Molecular Formula: C₆H₃BrClI

Custom Q&A

What is the molecular formula of 1-Bromo-3-chloro-4-iodobenzene?

The molecular formula of 1-Bromo-3-chloro-4-iodobenzene is C6H3BrClI.

What is the molecular weight of 1-Bromo-3-chloro-4-iodobenzene?

The molecular weight of 1-Bromo-3-chloro-4-iodobenzene is 317.35 g/mol.

What is the IUPAC name of 1-Bromo-3-chloro-4-iodobenzene?

The IUPAC name of 1-Bromo-3-chloro-4-iodobenzene is 4-bromo-2-chloro-1-iodobenzene.

What is the InChI of 1-Bromo-3-chloro-4-iodobenzene?

The InChI of 1-Bromo-3-chloro-4-iodobenzene is InChI=1S/C6H3BrClI/c7-4-1-2-6(9)5(8)3-4/h1-3H.

What is the InChIKey of 1-Bromo-3-chloro-4-iodobenzene?

The InChIKey of 1-Bromo-3-chloro-4-iodobenzene is OHHKQBZOURGNLR-UHFFFAOYSA-N.

What is the canonical SMILES of 1-Bromo-3-chloro-4-iodobenzene?

The canonical SMILES of 1-Bromo-3-chloro-4-iodobenzene is C1=CC(=C(C=C1Br)Cl)I.

What is the CAS number of 1-Bromo-3-chloro-4-iodobenzene?

The CAS number of 1-Bromo-3-chloro-4-iodobenzene is 31928-47-9.

How many hydrogen bond donor counts does 1-Bromo-3-chloro-4-iodobenzene have?

1-Bromo-3-chloro-4-iodobenzene has zero hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 1-Bromo-3-chloro-4-iodobenzene have?

1-Bromo-3-chloro-4-iodobenzene has zero hydrogen bond acceptor counts.