What is the molecular formula of 5-bromo-2,4-difluorobenzene-1-sulfonyl chloride?
The molecular formula is C6H2BrClF2O2S.
What is the molecular weight of 5-bromo-2,4-difluorobenzene-1-sulfonyl chloride?
The molecular weight is 291.50 g/mol.
What is the IUPAC name of 5-bromo-2,4-difluorobenzenesulfonyl chloride?
The IUPAC name is 5-bromo-2,4-difluorobenzenesulfonyl chloride.
What is the InChI code for 5-bromo-2,4-difluorobenzenesulfonyl chloride?
The InChI code is InChI=1S/C6H2BrClF2O2S/c7-3-1-6(13(8,11)12)5(10)2-4(3)9/h1-2H.
What is the InChIKey for 5-bromo-2,4-difluorobenzenesulfonyl chloride?
The InChIKey is GSNAPAYUOACKRN-UHFFFAOYSA-N.
What is the canonical SMILES representation of 5-bromo-2,4-difluorobenzenesulfonyl chloride?
The canonical SMILES representation is C1=C(C(=CC(=C1F)Br)S(=O)(=O)Cl)F.
What is the CAS number of 5-bromo-2,4-difluorobenzenesulfonyl chloride?
The CAS number is 287172-61-6.
What is the European Community (EC) number of 5-bromo-2,4-difluorobenzenesulfonyl chloride?
The EC number is 638-977-6.
What is the XLogP3-AA value of 5-bromo-2,4-difluorobenzenesulfonyl chloride?
The XLogP3-AA value is 2.8.
Is 5-bromo-2,4-difluorobenzenesulfonyl chloride a canonicalized compound in PubChem?
Yes, it is canonicalized.