What is the molecular formula of 5-Bromo-1H-benzimidazole?
The molecular formula of 5-Bromo-1H-benzimidazole is C7H5BrN2.
What is the molecular weight of 5-Bromo-1H-benzimidazole?
The molecular weight of 5-Bromo-1H-benzimidazole is 197.03 g/mol.
What is the IUPAC name of 5-Bromo-1H-benzimidazole?
The IUPAC name of 5-Bromo-1H-benzimidazole is 6-bromo-1H-benzimidazole.
What is the InChI of 5-Bromo-1H-benzimidazole?
The InChI of 5-Bromo-1H-benzimidazole is InChI=1S/C7H5BrN2/c8-5-1-2-6-7(3-5)10-4-9-6/h1-4H,(H,9,10).
What is the InChIKey of 5-Bromo-1H-benzimidazole?
The InChIKey of 5-Bromo-1H-benzimidazole is GEDVWGDBMPJNEV-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromo-1H-benzimidazole?
The canonical SMILES of 5-Bromo-1H-benzimidazole is C1=CC2=C(C=C1Br)NC=N2.
What is the CAS number of 5-Bromo-1H-benzimidazole?
The CAS number of 5-Bromo-1H-benzimidazole is 4887-88-1.
What is the EC number of 5-Bromo-1H-benzimidazole?
The EC number of 5-Bromo-1H-benzimidazole is 626-238-0.
What is the XLogP3 value of 5-Bromo-1H-benzimidazole?
The XLogP3 value of 5-Bromo-1H-benzimidazole is 2.5.
Is 5-Bromo-1H-benzimidazole a canonicalized compound?
Yes, 5-Bromo-1H-benzimidazole is a canonicalized compound.