What is the molecular formula of 4-Methylindoline?
The molecular formula of 4-Methylindoline is C9H11N.
What is the molecular weight of 4-Methylindoline?
The molecular weight of 4-Methylindoline is 133.19 g/mol.
What is the IUPAC name of 4-Methylindoline?
The IUPAC name of 4-Methylindoline is 4-methyl-2,3-dihydro-1H-indole.
What is the InChI of 4-Methylindoline?
The InChI of 4-Methylindoline is InChI=1S/C9H11N/c1-7-3-2-4-9-8(7)5-6-10-9/h2-4,10H,5-6H2,1H3.
What is the InChIKey of 4-Methylindoline?
The InChIKey of 4-Methylindoline is BSRIUSPUGCAPHE-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Methylindoline?
The canonical SMILES of 4-Methylindoline is CC1=C2CCNC2=CC=C1.
What is the CAS number of 4-Methylindoline?
The CAS number of 4-Methylindoline is 62108-16-1.
What is the XLogP3-AA value of 4-Methylindoline?
The XLogP3-AA value of 4-Methylindoline is 2.3.
How many hydrogen bond donor counts does 4-Methylindoline have?
4-Methylindoline has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 4-Methylindoline have?
4-Methylindoline has 1 hydrogen bond acceptor count.