What is the molecular formula of 4-Chloroindoline?
The molecular formula is C8H8ClN.
What is the molecular weight of 4-Chloroindoline?
The molecular weight is 153.61 g/mol.
What is the IUPAC name of 4-Chloroindoline?
The IUPAC name is 4-chloro-2,3-dihydro-1H-indole.
What is the InChI of 4-Chloroindoline?
The InChI is InChI=1S/C8H8ClN/c9-7-2-1-3-8-6(7)4-5-10-8/h1-3,10H,4-5H2.
What is the InChIKey of 4-Chloroindoline?
The InChIKey is BBHMZHDPVNXFMI-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Chloroindoline?
The canonical SMILES is C1CNC2=C1C(=CC=C2)Cl.
What is the CAS number of 4-Chloroindoline?
The CAS number is 41910-64-9.
What is the exact mass of 4-Chloroindoline?
The exact mass is 153.0345270 g/mol.
How many hydrogen bond donor counts does 4-Chloroindoline have?
It has 1 hydrogen bond donor count.
Is 4-Chloroindoline a canonicalized compound?
Yes, it is a canonicalized compound.