What is the molecular formula of 4-Bromo-6-fluoroindole?
The molecular formula of 4-Bromo-6-fluoroindole is C8H5BrFN.
What is the molecular weight of 4-Bromo-6-fluoroindole?
The molecular weight of 4-Bromo-6-fluoroindole is 214.03 g/mol.
What is the IUPAC name of 4-Bromo-6-fluoroindole?
The IUPAC name of 4-Bromo-6-fluoroindole is 4-bromo-6-fluoro-1H-indole.
What is the InChI of 4-Bromo-6-fluoroindole?
The InChI of 4-Bromo-6-fluoroindole is InChI=1S/C8H5BrFN/c9-7-3-5(10)4-8-6(7)1-2-11-8/h1-4,11H.
What is the InChIKey of 4-Bromo-6-fluoroindole?
The InChIKey of 4-Bromo-6-fluoroindole is DMOWKZSCECYXSE-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-6-fluoroindole?
The canonical SMILES of 4-Bromo-6-fluoroindole is C1=CNC2=C1C(=CC(=C2)F)Br.
What is the CAS number of 4-Bromo-6-fluoroindole?
The CAS number of 4-Bromo-6-fluoroindole is 885520-70-7.
What is the molecular weight of 4-Bromo-6-fluoroindole calculated by PubChem?
The molecular weight of 4-Bromo-6-fluoroindole is 214.03 g/mol, computed by PubChem 2.1.
What is the hydrogen bond donor count of 4-Bromo-6-fluoroindole?
The hydrogen bond donor count of 4-Bromo-6-fluoroindole is 1.
Is 4-Bromo-6-fluoroindole a canonicalized compound?
Yes, 4-Bromo-6-fluoroindole is a canonicalized compound, computed by PubChem.