What is the molecular formula of Ethyl 2-(4-bromophenyl)thiazole-4-carboxylate?
The molecular formula is C12H10BrNO2S.
What are the synonyms of Ethyl 2-(4-bromophenyl)thiazole-4-carboxylate?
Some of the synonyms include 885278-75-1, 2-(4-Bromo-phenyl)-thiazole-4-carboxylic acid ethyl ester, ethyl 2-(4-bromophenyl)-1,3-thiazole-4-carboxylate.
What is the molecular weight of Ethyl 2-(4-bromophenyl)thiazole-4-carboxylate?
The molecular weight is 312.18 g/mol.
What is the IUPAC name of Ethyl 2-(4-bromophenyl)thiazole-4-carboxylate?
The IUPAC name is ethyl 2-(4-bromophenyl)-1,3-thiazole-4-carboxylate.
What is the InChI of Ethyl 2-(4-bromophenyl)thiazole-4-carboxylate?
The InChI is InChI=1S/C12H10BrNO2S/c1-2-16-12(15)10-7-17-11(14-10)8-3-5-9(13)6-4-8/h3-7H,2H2,1H3.
What is the InChIKey of Ethyl 2-(4-bromophenyl)thiazole-4-carboxylate?
The InChIKey is SJTSPSRXMTVFAU-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl 2-(4-bromophenyl)thiazole-4-carboxylate?
The canonical SMILES is CCOC(=O)C1=CSC(=N1)C2=CC=C(C=C2)Br.
What is the CAS number of Ethyl 2-(4-bromophenyl)thiazole-4-carboxylate?
The CAS number is 885278-75-1.
Is Ethyl 2-(4-bromophenyl)thiazole-4-carboxylate a canonical compound?
Yes, Ethyl 2-(4-bromophenyl)thiazole-4-carboxylate is a canonical compound.
※ Please kindly note that our products are for research use only.