849021-12-1 Purity
95%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H12BNO3.
The synonyms of the compound are 850567-29-2, 3-Allylaminocarbonylphenylboronic acid, (3-(Allylcarbamoyl)phenyl)boronic acid, [3-(prop-2-enylcarbamoyl)phenyl]boronic Acid, and (3-Allylaminocarbonyl)phenylboronic acid.
The molecular weight of the compound is 205.02 g/mol.
The IUPAC name of the compound is [3-(prop-2-enylcarbamoyl)phenyl]boronic acid.
The InChI of the compound is InChI=1S/C10H12BNO3/c1-2-6-12-10(13)8-4-3-5-9(7-8)11(14)15/h2-5,7,14-15H,1,6H2,(H,12,13).
The InChIKey of the compound is BGDGMVTUXWBLLR-UHFFFAOYSA-N.
The canonical SMILES of the compound is B(C1=CC(=CC=C1)C(=O)NCC=C)(O)O.
The CAS number of the compound is 850567-29-2.
The hydrogen bond donor count of the compound is 3.
The hydrogen bond acceptor count of the compound is 3.
Please kindly note that our products are for research use only.
Download