[3-(2-Amino-1-methylethoxy)phenyl]dimethylamine

• Catalog Number: ACMA00002111
• Category: Ethers
• Molecular Weight: 194.27
• Molecular Formula: C₁₁H₁₇NO
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of [3-(2-Amino-1-methylethoxy)phenyl]dimethylamine?

The molecular formula is C11H18N2O.

What is the molecular weight of [3-(2-Amino-1-methylethoxy)phenyl]dimethylamine?

The molecular weight is 194.27 g/mol.

What is the IUPAC name of [3-(2-Amino-1-methylethoxy)phenyl]dimethylamine?

The IUPAC name is 3-(1-aminopropan-2-yloxy)-N,N-dimethylaniline.

What is the InChI of [3-(2-Amino-1-methylethoxy)phenyl]dimethylamine?

The InChI is InChI=1S/C11H18N2O/c1-9(8-12)14-11-6-4-5-10(7-11)13(2)3/h4-7,9H,8,12H2,1-3H3.

What is the InChIKey of [3-(2-Amino-1-methylethoxy)phenyl]dimethylamine?

The InChIKey is KIGBAFDNIUNIRG-UHFFFAOYSA-N.

What is the canonical SMILES of [3-(2-Amino-1-methylethoxy)phenyl]dimethylamine?

The canonical SMILES is CC(CN)OC1=CC=CC(=C1)N(C)C.

What is the CAS number of [3-(2-Amino-1-methylethoxy)phenyl]dimethylamine?

The CAS number is 887344-41-4.

How many hydrogen bond donor atoms does [3-(2-Amino-1-methylethoxy)phenyl]dimethylamine have?

It has 1 hydrogen bond donor atom.

What is the topological polar surface area of [3-(2-Amino-1-methylethoxy)phenyl]dimethylamine?

The topological polar surface area is 38.5Ų.