What is the molecular formula of 2-Mesitylethanol?
The molecular formula of 2-Mesitylethanol is C11H16O.
What is the molecular weight of 2-Mesitylethanol?
The molecular weight of 2-Mesitylethanol is 164.24 g/mol.
What is the IUPAC name of 2-Mesitylethanol?
The IUPAC name of 2-Mesitylethanol is 2-(2,4,6-trimethylphenyl)ethanol.
What is the InChI of 2-Mesitylethanol?
The InChI of 2-Mesitylethanol is InChI=1S/C11H16O/c1-8-6-9(2)11(4-5-12)10(3)7-8/h6-7,12H,4-5H2,1-3H3.
What is the InChIKey of 2-Mesitylethanol?
The InChIKey of 2-Mesitylethanol is FQZPTDPHVFTOSY-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Mesitylethanol?
The canonical SMILES of 2-Mesitylethanol is CC1=CC(=C(C(=C1)C)CCO)C.
What is the CAS number of 2-Mesitylethanol?
The CAS number of 2-Mesitylethanol is 6950-92-1.
What is the European Community (EC) number of 2-Mesitylethanol?
The European Community (EC) number of 2-Mesitylethanol is 230-123-7.
What is the UNII of 2-Mesitylethanol?
The UNII of 2-Mesitylethanol is PW9B824K7A.
Is 2-Mesitylethanol a canonicalized compound?
Yes, 2-Mesitylethanol is a canonicalized compound.