What is the molecular formula of 2,6-Difluoro-4-methoxybenzoyl chloride?
The molecular formula is C8H5ClF2O2.
What is the molecular weight of 2,6-Difluoro-4-methoxybenzoyl chloride?
The molecular weight is 206.57 g/mol.
What is the IUPAC name of 2,6-Difluoro-4-methoxybenzoyl chloride?
The IUPAC name is 2,6-difluoro-4-methoxybenzoyl chloride.
What is the canonical SMILES representation of 2,6-Difluoro-4-methoxybenzoyl chloride?
The canonical SMILES is COC1=CC(=C(C(=C1)F)C(=O)Cl)F.
What is the CAS number of 2,6-Difluoro-4-methoxybenzoyl chloride?
The CAS number is 125369-56-4.
What is the XLogP3-AA value of 2,6-Difluoro-4-methoxybenzoyl chloride?
The XLogP3-AA value is 2.6.
How many hydrogen bond donor counts are there in 2,6-Difluoro-4-methoxybenzoyl chloride?
There are 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are there in 2,6-Difluoro-4-methoxybenzoyl chloride?
There are 4 hydrogen bond acceptor counts.
How many rotatable bond counts are there in 2,6-Difluoro-4-methoxybenzoyl chloride?
There are 2 rotatable bond counts.
Is 2,6-Difluoro-4-methoxybenzoyl chloride a canonicalized compound in PubChem?
Yes, it is a canonicalized compound.