What is the molecular formula of 2,5-Disulfoaniline?
The molecular formula is C6H7NO6S2.
What is the molecular weight of 2,5-Disulfoaniline?
The molecular weight is 253.3 g/mol.
What is the IUPAC name of 2,5-Disulfoaniline?
The IUPAC name is 2-aminobenzene-1,4-disulfonic acid.
What is the InChI of 2,5-Disulfoaniline?
The InChI is InChI=1S/C6H7NO6S2/c7-5-3-4(14(8,9)10)1-2-6(5)15(11,12)13/h1-3H,7H2,(H,8,9,10)(H,11,12,13).
What is the InChIKey of 2,5-Disulfoaniline?
The InChIKey is LDCCBULMAFILCT-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Disulfoaniline?
The canonical SMILES is C1=CC(=C(C=C1S(=O)(=O)O)N)S(=O)(=O)O.
What is the CAS number of 2,5-Disulfoaniline?
The CAS number is 98-44-2.
How many hydrogen bond donor counts does 2,5-Disulfoaniline have?
It has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2,5-Disulfoaniline have?
It has 7 hydrogen bond acceptor counts.