What is the molecular formula of 2,5-Diphenyloxazole?
The molecular formula of 2,5-Diphenyloxazole is C15H11NO.
What is the molecular weight of 2,5-Diphenyloxazole?
The molecular weight of 2,5-Diphenyloxazole is 221.25 g/mol.
What is the IUPAC name of 2,5-Diphenyloxazole?
The IUPAC name of 2,5-Diphenyloxazole is 2,5-diphenyl-1,3-oxazole.
What is the InChI of 2,5-Diphenyloxazole?
The InChI of 2,5-Diphenyloxazole is InChI=1S/C15H11NO/c1-3-7-12(8-4-1)14-11-16-15(17-14)13-9-5-2-6-10-13/h1-11H.
What is the InChIKey of 2,5-Diphenyloxazole?
The InChIKey of 2,5-Diphenyloxazole is CNRNYORZJGVOSY-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Diphenyloxazole?
The canonical SMILES of 2,5-Diphenyloxazole is C1=CC=C(C=C1)C2=CN=C(O2)C3=CC=CC=C3.
What is the CAS number of 2,5-Diphenyloxazole?
The CAS number of 2,5-Diphenyloxazole is 92-71-7.
What is the European Community (EC) number of 2,5-Diphenyloxazole?
The European Community (EC) number of 2,5-Diphenyloxazole is 202-181-3.
What is the UNII of 2,5-Diphenyloxazole?
The UNII of 2,5-Diphenyloxazole is 2P8A647RYF.