What is the molecular formula of 2,4-Dimethyl-3-pentanol?
The molecular formula is C7H16O.
What is the molecular weight of 2,4-Dimethyl-3-pentanol?
The molecular weight is 116.20 g/mol.
What is the IUPAC name of 2,4-Dimethyl-3-pentanol?
The IUPAC name is 2,4-dimethylpentan-3-ol.
What is the InChI of 2,4-Dimethyl-3-pentanol?
The InChI is InChI=1S/C7H16O/c1-5(2)7(8)6(3)4/h5-8H,1-4H3.
What is the InChIKey of 2,4-Dimethyl-3-pentanol?
The InChIKey is BAYAKMPRFGNNFW-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4-Dimethyl-3-pentanol?
The canonical SMILES is CC(C)C(C(C)C)O.
What is the CAS number of 2,4-Dimethyl-3-pentanol?
The CAS number is 600-36-2.
What is the European Community (EC) Number of 2,4-Dimethyl-3-pentanol?
The European Community (EC) Number is 209-993-7.
What is the ChEMBL ID of 2,4-Dimethyl-3-pentanol?
The ChEMBL ID is CHEMBL2260956.
What is the XLogP3-AA value of 2,4-Dimethyl-3-pentanol?
The XLogP3-AA value is 2.3.