What is the molecular formula of 2-Iodobenzyl chloride?
The molecular formula of 2-Iodobenzyl chloride is C7H6ClI.
What is the molecular weight of 2-Iodobenzyl chloride?
The molecular weight of 2-Iodobenzyl chloride is 252.48 g/mol.
What is the IUPAC name of 2-Iodobenzyl chloride?
The IUPAC name of 2-Iodobenzyl chloride is 1-(chloromethyl)-2-iodobenzene.
What is the InChI of 2-Iodobenzyl chloride?
The InChI of 2-Iodobenzyl chloride is InChI=1S/C7H6ClI/c8-5-6-3-1-2-4-7(6)9/h1-4H,5H2.
What is the InChIKey of 2-Iodobenzyl chloride?
The InChIKey of 2-Iodobenzyl chloride is FTMNWZHKQGKKAU-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Iodobenzyl chloride?
The canonical SMILES of 2-Iodobenzyl chloride is C1=CC=C(C(=C1)CCl)I.
What is the CAS number of 2-Iodobenzyl chloride?
The CAS number of 2-Iodobenzyl chloride is 59473-45-9.
What is the European Community (EC) number of 2-Iodobenzyl chloride?
The European Community (EC) number of 2-Iodobenzyl chloride is 261-779-2.
What is the UNII of 2-Iodobenzyl chloride?
The UNII of 2-Iodobenzyl chloride is J618WT46OL.