2-(3,4-Difluorophenoxy)benzenecarbaldehyde

• Catalog Number: ACMA00002391
• Category: Ethers
• Molecular Weight: 234.20
• Molecular Formula: C₁₄H₂₂N₂O₂
• Hazard Statements: H302-H410
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C13H8F2O2.

What is the IUPAC name of the compound?

The IUPAC name is 2-(3,4-difluorophenoxy)benzaldehyde.

What is the InChI key of the compound?

The InChI key is XOJHFAVMLHRBBZ-UHFFFAOYSA-N.

What is the canonical SMILES representation of the compound?

The canonical SMILES representation is C1=CC=C(C(=C1)C=O)OC2=CC(=C(C=C2)F)F.

What is the molecular weight of the compound?

The molecular weight is 234.20 g/mol.

How many hydrogen bond donor atoms are there in the compound?

There are 0 hydrogen bond donor atoms in the compound.

How many hydrogen bond acceptor atoms are there in the compound?

There are 4 hydrogen bond acceptor atoms in the compound.

How many rotatable bonds are there in the compound?

There are 3 rotatable bonds in the compound.

What is the topological polar surface area of the compound?

The topological polar surface area is 26.3Ų.

How many heavy atoms are there in the compound?

There are 17 heavy atoms in the compound.